C21H23FO4 — CID 130191472
(3-fluoro-4-methylphenyl) 4-[(3-propyloxetan-3-yl)methoxy]benzoate (PubChem CID 130191472) has the molecular formula C21H23FO4 and a molecular weight of 358.41 g/mol. Its IUPAC name is (3-fluoro-4-methylphenyl) 4-[(3-propyloxetan-3-yl)methoxy]benzoate.
| Compound Name | (3-fluoro-4-methylphenyl) 4-[(3-propyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 130191472 |
| Molecular Formula | C21H23FO4 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (3-fluoro-4-methylphenyl) 4-[(3-propyloxetan-3-yl)methoxy]benzoate |
| SMILES | CCCC1(COc2ccc(C(=O)Oc3ccc(C)c(F)c3)cc2)COC1 |
| InChI | InChI=1S/C21H23FO4/c1-3-10-21(12-24-13-21)14-25-17-8-5-16(6-9-17)20(23)26-18-7-4-15(2)19(22)11-18/h4-9,11H,3,10,12-14H2,1-2H3 |
| InChIKey | HNFPWTLZCQIQCD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|