C11H17N — CID 130192609
N-methyl-N-propylcyclohepta-1,4,6-trien-1-amine (PubChem CID 130192609) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-methyl-N-propylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-methyl-N-propylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 130192609 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-methyl-N-propylcyclohepta-1,4,6-trien-1-amine |
| SMILES | CCCN(C)C1=CCC=CC=C1 |
| InChI | InChI=1S/C11H17N/c1-3-10-12(2)11-8-6-4-5-7-9-11/h4-6,8-9H,3,7,10H2,1-2H3 |
| InChIKey | VIYRAWOEAADOFP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |