C39H65NO3 — CID 130197537
[(Z)-non-2-enyl] 8-[5-[3-[(Z)-undec-4-enoyl]phenyl]pentylamino]octanoate (PubChem CID 130197537) has the molecular formula C39H65NO3 and a molecular weight of 595.95 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[5-[3-[(Z)-undec-4-enoyl]phenyl]pentylamino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[5-[3-[(Z)-undec-4-enoyl]phenyl]pentylamino]octanoate |
|---|---|
| PubChem CID | 130197537 |
| Molecular Formula | C39H65NO3 |
| Molecular Weight | 595.95 g/mol |
| Exact Mass | 595.50 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[5-[3-[(Z)-undec-4-enoyl]phenyl]pentylamino]octanoate |
| SMILES | CCCCCC/C=C\CCC(=O)c1cccc(CCCCCNCCCCCCCC(=O)OC/C=C\CCCCCC)c1 |
| InChI | InChI=1S/C39H65NO3/c1-3-5-7-9-11-12-15-21-30-38(41)37-29-26-28-36(35-37)27-20-19-24-33-40-32-23-17-14-16-22-31-39(42)43-34-25-18-13-10-8-6-4-2/h12,15,18,25-26,28-29,35,40H,3-11,13-14,16-17,19-24,27,30-34H2,1-2H3/b15-12-,25-18- |
| InChIKey | DZAPQBPLWCXLBL-WZPWCSTLSA-N |
| XLogP | 10.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.95 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|