C7H12IN — CID 130198454
cis-(2R,3S)-2-cyclopropyl-3-iodocyclobutan-1-amine (PubChem CID 130198454) has the molecular formula C7H12IN and a molecular weight of 237.08 g/mol. Its IUPAC name is cis-(2R,3S)-2-cyclopropyl-3-iodocyclobutan-1-amine.
| Compound Name | cis-(2R,3S)-2-cyclopropyl-3-iodocyclobutan-1-amine |
|---|---|
| PubChem CID | 130198454 |
| Molecular Formula | C7H12IN |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | cis-(2R,3S)-2-cyclopropyl-3-iodocyclobutan-1-amine |
| SMILES | NC1C[C@H](I)[C@@H]1C1CC1 |
| InChI | InChI=1S/C7H12IN/c8-5-3-6(9)7(5)4-1-2-4/h4-7H,1-3,9H2/t5-,6?,7-/m0/s1 |
| InChIKey | YCBYWHHRCOXWLP-LOJRBXKRSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|