C22H25N3O2 — CID 130200323
2-methyl-6-phenyl-5-propan-2-yl-2,4,6-triazatricyclo[8.5.0.03,8]pentadeca-1(10),3(8),4-triene-7,9-dione (PubChem CID 130200323) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-methyl-6-phenyl-5-propan-2-yl-2,4,6-triazatricyclo[8.5.0.03,8]pentadeca-1(10),3(8),4-triene-7,9-dione.
| Compound Name | 2-methyl-6-phenyl-5-propan-2-yl-2,4,6-triazatricyclo[8.5.0.03,8]pentadeca-1(10),3(8),4-triene-7,9-dione |
|---|---|
| PubChem CID | 130200323 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-methyl-6-phenyl-5-propan-2-yl-2,4,6-triazatricyclo[8.5.0.03,8]pentadeca-1(10),3(8),4-triene-7,9-dione |
| SMILES | CC(C)c1nc2c(c(=O)c3c(n2C)CCCCC3)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H25N3O2/c1-14(2)20-23-21-18(22(27)25(20)15-10-6-4-7-11-15)19(26)16-12-8-5-9-13-17(16)24(21)3/h4,6-7,10-11,14H,5,8-9,12-13H2,1-3H3 |
| InChIKey | LRVOTIFBBXZWQE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |