C24H25N3O2 — CID 118523629
10-(2-methylpropyl)-3-phenyl-2-propan-2-ylpyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 118523629) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 10-(2-methylpropyl)-3-phenyl-2-propan-2-ylpyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 10-(2-methylpropyl)-3-phenyl-2-propan-2-ylpyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 118523629 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 10-(2-methylpropyl)-3-phenyl-2-propan-2-ylpyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | CC(C)Cn1c2ccccc2c(=O)c2c(=O)n(-c3ccccc3)c(C(C)C)nc21 |
| InChI | InChI=1S/C24H25N3O2/c1-15(2)14-26-19-13-9-8-12-18(19)21(28)20-23(26)25-22(16(3)4)27(24(20)29)17-10-6-5-7-11-17/h5-13,15-16H,14H2,1-4H3 |
| InChIKey | GISBHBWTJXZJHR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|