About (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine
(2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine (PubChem CID 130204472) has the molecular formula C8H20N2S
and a molecular weight of 176.33 g/mol. Its IUPAC name is (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 130204472 |
| Molecular Formula | C8H20N2S |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine |
| SMILES | C[C@@H](CN(C)C)SC(C)(C)N |
| InChI | InChI=1S/C8H20N2S/c1-7(6-10(4)5)11-8(2,3)9/h7H,6,9H2,1-5H3/t7-/m0/s1 |
| InChIKey | ATKFRHSAFDNXBW-ZETCQYMHSA-N |
| XLogP | 1.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine?
The IUPAC name of (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine (CID 130204472) is (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine is C[C@@H](CN(C)C)SC(C)(C)N.
What is the InChIKey of (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine?
The InChIKey is ATKFRHSAFDNXBW-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H20N2S/c1-7(6-10(4)5)11-8(2,3)9/h7H,6,9H2,1-5H3/t7-/m0/s1.
What are the key properties of (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine?
(2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine has a molecular weight of 176.33 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-aminopropan-2-ylsulfanyl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 130204472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).