C7H17NS — CID 123426683
2-ethylsulfanyl-N,N-dimethylpropan-1-amine (PubChem CID 123426683) has the molecular formula C7H17NS and a molecular weight of 147.29 g/mol. Its IUPAC name is 2-ethylsulfanyl-N,N-dimethylpropan-1-amine.
| Compound Name | 2-ethylsulfanyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 123426683 |
| Molecular Formula | C7H17NS |
| Molecular Weight | 147.29 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 2-ethylsulfanyl-N,N-dimethylpropan-1-amine |
| SMILES | CCSC(C)CN(C)C |
| InChI | InChI=1S/C7H17NS/c1-5-9-7(2)6-8(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | GCVULDYWPQGGFD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |