C17H24N2O7S — CID 130207889
N-hydroxy-4-[4-(5-hydroxy-4-methoxypent-1-ynyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 130207889) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is N-hydroxy-4-[4-(5-hydroxy-4-methoxypent-1-ynyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[4-(5-hydroxy-4-methoxypent-1-ynyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 130207889 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-hydroxy-4-[4-(5-hydroxy-4-methoxypent-1-ynyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COC(CO)CC#Cc1ccn(CCC(C)(C(=O)NO)S(C)(=O)=O)c(=O)c1 |
| InChI | InChI=1S/C17H24N2O7S/c1-17(16(22)18-23,27(3,24)25)8-10-19-9-7-13(11-15(19)21)5-4-6-14(12-20)26-2/h7,9,11,14,20,23H,6,8,10,12H2,1-3H3,(H,18,22) |
| InChIKey | NPLBMFKAOTXBRX-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|