C10H9FO — CID 130209558
5-fluoro-1,3-dimethyl-2-benzofuran (PubChem CID 130209558) has the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-2-benzofuran.
| Compound Name | 5-fluoro-1,3-dimethyl-2-benzofuran |
|---|---|
| PubChem CID | 130209558 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-2-benzofuran |
| SMILES | Cc1oc(C)c2cc(F)ccc12 |
| InChI | InChI=1S/C10H9FO/c1-6-9-4-3-8(11)5-10(9)7(2)12-6/h3-5H,1-2H3 |
| InChIKey | BQNWKOVPRJHLEL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |