About 5-fluoro-1,3-dimethyl-2-benzofuran
5-fluoro-1,3-dimethyl-2-benzofuran (PubChem CID 130209558) has the molecular formula C10H9FO
and a molecular weight of 164.18 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-2-benzofuran.
Molecular Properties
| Compound Name | 5-fluoro-1,3-dimethyl-2-benzofuran |
| PubChem CID | 130209558 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-2-benzofuran |
| SMILES | Cc1oc(C)c2cc(F)ccc12 |
| InChI | InChI=1S/C10H9FO/c1-6-9-4-3-8(11)5-10(9)7(2)12-6/h3-5H,1-2H3 |
| InChIKey | BQNWKOVPRJHLEL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1,3-dimethyl-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-dimethyl-2-benzofuran?
The IUPAC name of 5-fluoro-1,3-dimethyl-2-benzofuran (CID 130209558) is 5-fluoro-1,3-dimethyl-2-benzofuran.
What is the SMILES notation for 5-fluoro-1,3-dimethyl-2-benzofuran?
The canonical SMILES for 5-fluoro-1,3-dimethyl-2-benzofuran is Cc1oc(C)c2cc(F)ccc12.
What is the InChIKey of 5-fluoro-1,3-dimethyl-2-benzofuran?
The InChIKey is BQNWKOVPRJHLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO/c1-6-9-4-3-8(11)5-10(9)7(2)12-6/h3-5H,1-2H3.
What are the key properties of 5-fluoro-1,3-dimethyl-2-benzofuran?
5-fluoro-1,3-dimethyl-2-benzofuran has a molecular weight of 164.18 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-dimethyl-2-benzofuran is sourced from PubChem (CID 130209558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).