C12H16NO4P — CID 130211088
[(2S)-1-oxo-1-phosphanyloxypropan-2-yl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 130211088) has the molecular formula C12H16NO4P and a molecular weight of 269.24 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phosphanyloxypropan-2-yl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [(2S)-1-oxo-1-phosphanyloxypropan-2-yl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 130211088 |
| Molecular Formula | C12H16NO4P |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [(2S)-1-oxo-1-phosphanyloxypropan-2-yl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | C[C@H](OC(=O)[C@@H](N)Cc1ccccc1)C(=O)OP |
| InChI | InChI=1S/C12H16NO4P/c1-8(11(14)17-18)16-12(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13,18H2,1H3/t8-,10-/m0/s1 |
| InChIKey | OLCWHZPBPUJPNG-WPRPVWTQSA-N |
| XLogP | 0.82 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|