C22H29N5O7S — CID 130215503
5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(3-methyl-2H-thiadiazol-4-yl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid (PubChem CID 130215503) has the molecular formula C22H29N5O7S and a molecular weight of 507.57 g/mol. Its IUPAC name is 5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(3-methyl-2H-thiadiazol-4-yl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(3-methyl-2H-thiadiazol-4-yl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130215503 |
| Molecular Formula | C22H29N5O7S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(3-methyl-2H-thiadiazol-4-yl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid |
| SMILES | CN1NSC=C1c1ccc(CCC(=O)N[C@@H](CCC(=O)O)C(=O)NC(CCC(=O)O)C(N)=O)cc1 |
| InChI | InChI=1S/C22H29N5O7S/c1-27-17(12-35-26-27)14-5-2-13(3-6-14)4-9-18(28)24-16(8-11-20(31)32)22(34)25-15(21(23)33)7-10-19(29)30/h2-3,5-6,12,15-16,26H,4,7-11H2,1H3,(H2,23,33)(H,24,28)(H,25,34)(H,29,30)(H,31,32)/t15?,16-/m0/s1 |
| InChIKey | ZKBYTHUKODMVDP-LYKKTTPLSA-N |
| XLogP | 0.20 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|