C23H33F3N3O2P — CID 130216216
N-[[1-[2-[(2-methylcyclohexyl)amino]acetyl]piperidin-4-yl]methyl]-3-phosphanyl-5-(trifluoromethyl)benzamide (PubChem CID 130216216) has the molecular formula C23H33F3N3O2P and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[[1-[2-[(2-methylcyclohexyl)amino]acetyl]piperidin-4-yl]methyl]-3-phosphanyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[2-[(2-methylcyclohexyl)amino]acetyl]piperidin-4-yl]methyl]-3-phosphanyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130216216 |
| Molecular Formula | C23H33F3N3O2P |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[[1-[2-[(2-methylcyclohexyl)amino]acetyl]piperidin-4-yl]methyl]-3-phosphanyl-5-(trifluoromethyl)benzamide |
| SMILES | CC1CCCCC1NCC(=O)N1CCC(CNC(=O)c2cc(P)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H33F3N3O2P/c1-15-4-2-3-5-20(15)27-14-21(30)29-8-6-16(7-9-29)13-28-22(31)17-10-18(23(24,25)26)12-19(32)11-17/h10-12,15-16,20,27H,2-9,13-14,32H2,1H3,(H,28,31) |
| InChIKey | ADELGLVPNYBSOL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|