C7H14N+ — CID 130217125
1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium (PubChem CID 130217125) has the molecular formula C7H14N+ and a molecular weight of 112.20 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium.
| Compound Name | 1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 130217125 |
| Molecular Formula | C7H14N+ |
| Molecular Weight | 112.20 g/mol |
| Exact Mass | 112.11 |
| IUPAC Name | 1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium |
| SMILES | C[N+]1(C)C=CCCC1 |
| InChI | InChI=1S/C7H14N/c1-8(2)6-4-3-5-7-8/h4,6H,3,5,7H2,1-2H3/q+1 |
| InChIKey | HNLUUXJCCRKZIJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|