C23H38O3S2 — CID 130217811
[2,4-bis(methylsulfanylmethyl)-6-octylphenyl] tert-butyl carbonate (PubChem CID 130217811) has the molecular formula C23H38O3S2 and a molecular weight of 426.69 g/mol. Its IUPAC name is [2,4-bis(methylsulfanylmethyl)-6-octylphenyl] tert-butyl carbonate.
| Compound Name | [2,4-bis(methylsulfanylmethyl)-6-octylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 130217811 |
| Molecular Formula | C23H38O3S2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [2,4-bis(methylsulfanylmethyl)-6-octylphenyl] tert-butyl carbonate |
| SMILES | CCCCCCCCc1cc(CSC)cc(CSC)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38O3S2/c1-7-8-9-10-11-12-13-19-14-18(16-27-5)15-20(17-28-6)21(19)25-22(24)26-23(2,3)4/h14-15H,7-13,16-17H2,1-6H3 |
| InChIKey | OMQKSZYXZJSFQO-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|