C61H88O6 — CID 130208228
tert-butyl [2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyloxy]-5-nonyl-3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-nonyl-6-(2-phenylpropan-2-yl)phenyl] carbonate (PubChem CID 130208228) has the molecular formula C61H88O6 and a molecular weight of 917.37 g/mol. Its IUPAC name is tert-butyl [2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyloxy]-5-nonyl-3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-nonyl-6-(2-phenylpropan-2-yl)phenyl] carbonate.
| Compound Name | tert-butyl [2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyloxy]-5-nonyl-3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-nonyl-6-(2-phenylpropan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 130208228 |
| Molecular Formula | C61H88O6 |
| Molecular Weight | 917.37 g/mol |
| Exact Mass | 916.66 |
| IUPAC Name | tert-butyl [2-[2-[2-[(2-methylpropan-2-yl)oxycarbonyloxy]-5-nonyl-3-(2-phenylpropan-2-yl)phenyl]propan-2-yl]-4-nonyl-6-(2-phenylpropan-2-yl)phenyl] carbonate |
| SMILES | CCCCCCCCCc1cc(C(C)(C)c2ccccc2)c(OC(=O)OC(C)(C)C)c(C(C)(C)c2cc(CCCCCCCCC)cc(C(C)(C)c3ccccc3)c2OC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C61H88O6/c1-15-17-19-21-23-25-29-35-45-41-49(59(9,10)47-37-31-27-32-38-47)53(64-55(62)66-57(3,4)5)51(43-45)61(13,14)52-44-46(36-30-26-24-22-20-18-16-2)42-50(54(52)65-56(63)67-58(6,7)8)60(11,12)48-39-33-28-34-40-48/h27-28,31-34,37-44H,15-26,29-30,35-36H2,1-14H3 |
| InChIKey | CKXHUAIZVSOXSW-UHFFFAOYSA-N |
| XLogP | 17.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.37 |
| LogP ≤ 5 | 17.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|