About 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene
4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene (PubChem CID 130223264) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene.
Molecular Properties
| Compound Name | 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene |
| PubChem CID | 130223264 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene |
| SMILES | CCCC1c2c(C(C)C)cnn21 |
| InChI | InChI=1S/C10H16N2/c1-4-5-9-10-8(7(2)3)6-11-12(9)10/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | ZWPBJXSERFVPAV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene?
The IUPAC name of 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene (CID 130223264) is 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene.
What is the SMILES notation for 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene?
The canonical SMILES for 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene is CCCC1c2c(C(C)C)cnn21.
What is the InChIKey of 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene?
The InChIKey is ZWPBJXSERFVPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-4-5-9-10-8(7(2)3)6-11-12(9)10/h6-7,9H,4-5H2,1-3H3.
What are the key properties of 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene?
4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene has a molecular weight of 164.25 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-6-propyl-1,2-diazabicyclo[3.1.0]hexa-2,4-diene is sourced from PubChem (CID 130223264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).