C10H17N — CID 130224675
N-[(2Z)-3,4-dimethylpenta-2,4-dien-2-yl]propan-2-imine (PubChem CID 130224675) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(2Z)-3,4-dimethylpenta-2,4-dien-2-yl]propan-2-imine.
| Compound Name | N-[(2Z)-3,4-dimethylpenta-2,4-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 130224675 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(2Z)-3,4-dimethylpenta-2,4-dien-2-yl]propan-2-imine |
| SMILES | C=C(C)/C(C)=C(/C)N=C(C)C |
| InChI | InChI=1S/C10H17N/c1-7(2)9(5)10(6)11-8(3)4/h1H2,2-6H3/b10-9- |
| InChIKey | QJMJHQXSFUXARC-KTKRTIGZSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|