C11H18FN — CID 168972356
N-[(2E)-3-fluoro-4-methylpenta-2,4-dien-2-yl]pentan-2-imine (PubChem CID 168972356) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is N-[(2E)-3-fluoro-4-methylpenta-2,4-dien-2-yl]pentan-2-imine.
| Compound Name | N-[(2E)-3-fluoro-4-methylpenta-2,4-dien-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 168972356 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-[(2E)-3-fluoro-4-methylpenta-2,4-dien-2-yl]pentan-2-imine |
| SMILES | C=C(C)/C(F)=C(C)\N=C(/C)CCC |
| InChI | InChI=1S/C11H18FN/c1-6-7-9(4)13-10(5)11(12)8(2)3/h2,6-7H2,1,3-5H3/b11-10+,13-9+ |
| InChIKey | USDILVPLGNNUGZ-XZKZINEMSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|