C11H10F9N — CID 162686723
3,3-difluoro-N-[(2E)-1,1,1,3-tetrafluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]pentan-2-imine (PubChem CID 162686723) has the molecular formula C11H10F9N and a molecular weight of 327.19 g/mol. Its IUPAC name is 3,3-difluoro-N-[(2E)-1,1,1,3-tetrafluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]pentan-2-imine.
| Compound Name | 3,3-difluoro-N-[(2E)-1,1,1,3-tetrafluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 162686723 |
| Molecular Formula | C11H10F9N |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3,3-difluoro-N-[(2E)-1,1,1,3-tetrafluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]pentan-2-imine |
| SMILES | C=C(/C(F)=C(\N=C(/C)C(F)(F)CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F9N/c1-4-9(13,14)6(3)21-8(11(18,19)20)7(12)5(2)10(15,16)17/h2,4H2,1,3H3/b8-7+,21-6+ |
| InChIKey | ACPNXNSZCWETSZ-GUUPPZATSA-N |
| XLogP | 5.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|