C12H16N2O2S2 — CID 130226504
(2R)-2-amino-3-sulfanylpropanoic acid;2-isothiocyanatoethylbenzene (PubChem CID 130226504) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;2-isothiocyanatoethylbenzene.
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-isothiocyanatoethylbenzene |
|---|---|
| PubChem CID | 130226504 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-isothiocyanatoethylbenzene |
| SMILES | N[C@@H](CS)C(=O)O.S=C=NCCc1ccccc1 |
| InChI | InChI=1S/C9H9NS.C3H7NO2S/c11-8-10-7-6-9-4-2-1-3-5-9;4-2(1-7)3(5)6/h1-5H,6-7H2;2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | TZGGDVIZNCINIA-WNQIDUERSA-N |
| XLogP | 1.66 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|