C15H23N3O2S — CID 175338677
2,6-diaminohexanoic acid;2-isothiocyanatoethylbenzene (PubChem CID 175338677) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;2-isothiocyanatoethylbenzene.
| Compound Name | 2,6-diaminohexanoic acid;2-isothiocyanatoethylbenzene |
|---|---|
| PubChem CID | 175338677 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2,6-diaminohexanoic acid;2-isothiocyanatoethylbenzene |
| SMILES | NCCCCC(N)C(=O)O.S=C=NCCc1ccccc1 |
| InChI | InChI=1S/C9H9NS.C6H14N2O2/c11-8-10-7-6-9-4-2-1-3-5-9;7-4-2-1-3-5(8)6(9)10/h1-5H,6-7H2;5H,1-4,7-8H2,(H,9,10) |
| InChIKey | XGTNYFDEGGOXOA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|