C15H22O8 — CID 130234240
(2R,3R,4S,5R)-7-(2,4-dimethoxyphenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 130234240) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7-(2,4-dimethoxyphenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5R)-7-(2,4-dimethoxyphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 130234240 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2R,3R,4S,5R)-7-(2,4-dimethoxyphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | COc1ccc(C=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c(OC)c1 |
| InChI | InChI=1S/C15H22O8/c1-22-9-4-3-8(12(6-9)23-2)5-10(17)13(19)15(21)14(20)11(18)7-16/h3-6,11,13-21H,7H2,1-2H3/t11-,13+,14-,15-/m1/s1 |
| InChIKey | BJDMXYRLBIWKSQ-FAAHXZRKSA-N |
| XLogP | -0.96 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|