C27H36O10 — CID 141459963
(2S,3R,4R,5R)-10-(2,4-dimethoxyphenyl)-7-[(2,4-dimethoxyphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol (PubChem CID 141459963) has the molecular formula C27H36O10 and a molecular weight of 520.58 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2,4-dimethoxyphenyl)-7-[(2,4-dimethoxyphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2,4-dimethoxyphenyl)-7-[(2,4-dimethoxyphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459963 |
| Molecular Formula | C27H36O10 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2,4-dimethoxyphenyl)-7-[(2,4-dimethoxyphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
| SMILES | COc1ccc(CC=C=C(Cc2ccc(OC)cc2OC)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c(OC)c1 |
| InChI | InChI=1S/C27H36O10/c1-34-19-10-8-16(22(13-19)36-3)6-5-7-18(12-17-9-11-20(35-2)14-23(17)37-4)24(30)26(32)27(33)25(31)21(29)15-28/h5,8-11,13-14,21,24-33H,6,12,15H2,1-4H3/t7?,21-,24?,25+,26+,27-/m0/s1 |
| InChIKey | QFRSQENECCXRNM-NAJYDFOASA-N |
| XLogP | 0.38 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |