C30H46O12 — CID 141459975
(2S,3R,4R,5R)-8-methyl-10-(2,4,5-trimethoxyphenyl)-7-[(2,4,5-trimethoxyphenyl)methyl]decane-1,2,3,4,5,6-hexol (PubChem CID 141459975) has the molecular formula C30H46O12 and a molecular weight of 598.69 g/mol. Its IUPAC name is (2S,3R,4R,5R)-8-methyl-10-(2,4,5-trimethoxyphenyl)-7-[(2,4,5-trimethoxyphenyl)methyl]decane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-8-methyl-10-(2,4,5-trimethoxyphenyl)-7-[(2,4,5-trimethoxyphenyl)methyl]decane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459975 |
| Molecular Formula | C30H46O12 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | (2S,3R,4R,5R)-8-methyl-10-(2,4,5-trimethoxyphenyl)-7-[(2,4,5-trimethoxyphenyl)methyl]decane-1,2,3,4,5,6-hexol |
| SMILES | COc1cc(OC)c(OC)cc1CCC(C)C(Cc1cc(OC)c(OC)cc1OC)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C30H46O12/c1-16(8-9-17-11-23(39-4)25(41-6)13-21(17)37-2)19(27(33)29(35)30(36)28(34)20(32)15-31)10-18-12-24(40-5)26(42-7)14-22(18)38-3/h11-14,16,19-20,27-36H,8-10,15H2,1-7H3/t16?,19?,20-,27?,28+,29+,30-/m0/s1 |
| InChIKey | JBBMEVIDZZLGLY-SLUMMNQVSA-N |
| XLogP | 0.96 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |