C16H24O6 — CID 77160649
7-(4-ethyl-3-methylphenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 77160649) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 7-(4-ethyl-3-methylphenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | 7-(4-ethyl-3-methylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 77160649 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 7-(4-ethyl-3-methylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccc(C=C(O)C(O)C(O)C(O)C(O)CO)cc1C |
| InChI | InChI=1S/C16H24O6/c1-3-11-5-4-10(6-9(11)2)7-12(18)14(20)16(22)15(21)13(19)8-17/h4-7,13-22H,3,8H2,1-2H3 |
| InChIKey | ZZTTUAWKNNKXHM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|