C15H22O6 — CID 141130875
(Z,2S,3R,4R,5R)-7-(2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 141130875) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (Z,2S,3R,4R,5R)-7-(2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (Z,2S,3R,4R,5R)-7-(2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141130875 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (Z,2S,3R,4R,5R)-7-(2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | Cc1ccc(/C=C(\O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)c(C)c1 |
| InChI | InChI=1S/C15H22O6/c1-8-3-4-10(9(2)5-8)6-11(17)13(19)15(21)14(20)12(18)7-16/h3-6,12-21H,7H2,1-2H3/b11-6-/t12-,13-,14+,15-/m0/s1 |
| InChIKey | WKMXOSDOLHYLDH-SBXDZDDVSA-N |
| XLogP | -0.36 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|