C17H26O6 — CID 172831301
(3S,4S,5R,6S)-1-(3,5-dimethylphenyl)non-1-ene-2,3,4,5,6,7-hexol (PubChem CID 172831301) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (3S,4S,5R,6S)-1-(3,5-dimethylphenyl)non-1-ene-2,3,4,5,6,7-hexol.
| Compound Name | (3S,4S,5R,6S)-1-(3,5-dimethylphenyl)non-1-ene-2,3,4,5,6,7-hexol |
|---|---|
| PubChem CID | 172831301 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3S,4S,5R,6S)-1-(3,5-dimethylphenyl)non-1-ene-2,3,4,5,6,7-hexol |
| SMILES | CCC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H26O6/c1-4-12(18)14(20)16(22)17(23)15(21)13(19)8-11-6-9(2)5-10(3)7-11/h5-8,12,14-23H,4H2,1-3H3/t12?,14-,15+,16+,17+/m0/s1 |
| InChIKey | VNWRCHJDXQPRIS-JWPDJGIDSA-N |
| XLogP | 0.42 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|