C15H21FO6 — CID 174465317
7-(3-fluoro-2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 174465317) has the molecular formula C15H21FO6 and a molecular weight of 316.33 g/mol. Its IUPAC name is 7-(3-fluoro-2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | 7-(3-fluoro-2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 174465317 |
| Molecular Formula | C15H21FO6 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 7-(3-fluoro-2,4-dimethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | Cc1ccc(C=C(O)C(O)C(O)C(O)C(O)CO)c(C)c1F |
| InChI | InChI=1S/C15H21FO6/c1-7-3-4-9(8(2)12(7)16)5-10(18)13(20)15(22)14(21)11(19)6-17/h3-5,11,13-15,17-22H,6H2,1-2H3 |
| InChIKey | BYAUFJVEETZBMA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|