C17H26O6 — CID 130234248
(2R,3R,4S,5R)-7-(2,4-diethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 130234248) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7-(2,4-diethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5R)-7-(2,4-diethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 130234248 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2R,3R,4S,5R)-7-(2,4-diethylphenyl)hept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccc(C=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c(CC)c1 |
| InChI | InChI=1S/C17H26O6/c1-3-10-5-6-12(11(4-2)7-10)8-13(19)15(21)17(23)16(22)14(20)9-18/h5-8,14-23H,3-4,9H2,1-2H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | FYZHFOIRNXQALY-YYIAUSFCSA-N |
| XLogP | 0.15 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|