C16H24O6 — CID 54188354
(3R,4S,5R,6R)-1-(4-ethyl-3-methylphenyl)-3,4,5,6,7-pentahydroxyheptan-2-one (PubChem CID 54188354) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3R,4S,5R,6R)-1-(4-ethyl-3-methylphenyl)-3,4,5,6,7-pentahydroxyheptan-2-one.
| Compound Name | (3R,4S,5R,6R)-1-(4-ethyl-3-methylphenyl)-3,4,5,6,7-pentahydroxyheptan-2-one |
|---|---|
| PubChem CID | 54188354 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3R,4S,5R,6R)-1-(4-ethyl-3-methylphenyl)-3,4,5,6,7-pentahydroxyheptan-2-one |
| SMILES | CCc1ccc(CC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1C |
| InChI | InChI=1S/C16H24O6/c1-3-11-5-4-10(6-9(11)2)7-12(18)14(20)16(22)15(21)13(19)8-17/h4-6,13-17,19-22H,3,7-8H2,1-2H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | PGSMMBMDEZJMCI-QKPAOTATSA-N |
| XLogP | -0.90 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |