C14H20O7 — CID 141192723
(4R,5S,6R,7R)-2-deuterio-4,5,6,7,8-pentahydroxy-1-(4-hydroxyphenyl)octan-3-one (PubChem CID 141192723) has the molecular formula C14H20O7 and a molecular weight of 301.31 g/mol. Its IUPAC name is (4R,5S,6R,7R)-2-deuterio-4,5,6,7,8-pentahydroxy-1-(4-hydroxyphenyl)octan-3-one.
| Compound Name | (4R,5S,6R,7R)-2-deuterio-4,5,6,7,8-pentahydroxy-1-(4-hydroxyphenyl)octan-3-one |
|---|---|
| PubChem CID | 141192723 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4R,5S,6R,7R)-2-deuterio-4,5,6,7,8-pentahydroxy-1-(4-hydroxyphenyl)octan-3-one |
| SMILES | [2H]C(Cc1ccc(O)cc1)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H20O7/c15-7-11(18)13(20)14(21)12(19)10(17)6-3-8-1-4-9(16)5-2-8/h1-2,4-5,11-16,18-21H,3,6-7H2/t11-,12+,13-,14-/m1/s1/i6D/t6?,11-,12+,13-,14- |
| InChIKey | DYBJYYPWNMQBCU-UPMWHQEFSA-N |
| XLogP | -1.67 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |