C14H20O7 — CID 102200460
[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 3-(4-hydroxyphenyl)propanoate (PubChem CID 102200460) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 3-(4-hydroxyphenyl)propanoate.
| Compound Name | [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 102200460 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] 3-(4-hydroxyphenyl)propanoate |
| SMILES | O=C(CCc1ccc(O)cc1)OC[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H20O7/c15-7-11(17)14(20)12(18)8-21-13(19)6-3-9-1-4-10(16)5-2-9/h1-2,4-5,11-12,14-18,20H,3,6-8H2/t11-,12+,14-/m1/s1 |
| InChIKey | YZGHSDUGDSDBME-MBNYWOFBSA-N |
| XLogP | -1.06 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |