C14H18N2O7 — CID 163573684
1,3-dicarbamoyloxypropan-2-yl 3-(4-hydroxyphenyl)propanoate (PubChem CID 163573684) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1,3-dicarbamoyloxypropan-2-yl 3-(4-hydroxyphenyl)propanoate.
| Compound Name | 1,3-dicarbamoyloxypropan-2-yl 3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 163573684 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1,3-dicarbamoyloxypropan-2-yl 3-(4-hydroxyphenyl)propanoate |
| SMILES | NC(=O)OCC(COC(N)=O)OC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C14H18N2O7/c15-13(19)21-7-11(8-22-14(16)20)23-12(18)6-3-9-1-4-10(17)5-2-9/h1-2,4-5,11,17H,3,6-8H2,(H2,15,19)(H2,16,20) |
| InChIKey | GBOSFGHTOGVJET-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|