About 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate
1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate (PubChem CID 57096058) has the molecular formula C12H11IO3
and a molecular weight of 330.12 g/mol. Its IUPAC name is 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate |
| PubChem CID | 57096058 |
| Molecular Formula | C12H11IO3 |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate |
| SMILES | C#CC(I)OC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H11IO3/c1-2-11(13)16-12(15)8-5-9-3-6-10(14)7-4-9/h1,3-4,6-7,11,14H,5,8H2 |
| InChIKey | BVRNYNOJZLUCBV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate?
The IUPAC name of 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate (CID 57096058) is 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate.
What is the SMILES notation for 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate?
The canonical SMILES for 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate is C#CC(I)OC(=O)CCc1ccc(O)cc1.
What is the InChIKey of 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate?
The InChIKey is BVRNYNOJZLUCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IO3/c1-2-11(13)16-12(15)8-5-9-3-6-10(14)7-4-9/h1,3-4,6-7,11,14H,5,8H2.
What are the key properties of 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate?
1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate has a molecular weight of 330.12 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoprop-2-ynyl 3-(4-hydroxyphenyl)propanoate is sourced from PubChem (CID 57096058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).