C66H67NO12 — CID 172522242
1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yl 4-[[4-[1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoate (PubChem CID 172522242) has the molecular formula C66H67NO12 and a molecular weight of 1066.26 g/mol. Its IUPAC name is 1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yl 4-[[4-[1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoate.
| Compound Name | 1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yl 4-[[4-[1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoate |
|---|---|
| PubChem CID | 172522242 |
| Molecular Formula | C66H67NO12 |
| Molecular Weight | 1066.26 g/mol |
| Exact Mass | 1065.47 |
| IUPAC Name | 1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yl 4-[[4-[1,3-bis(3-naphthalen-2-ylpropanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoate |
| SMILES | O=C(CCc1ccc2ccccc2c1)OCC(COC(=O)CCc1ccc2ccccc2c1)OC(=O)CCCNCCCC(=O)OC(COC(=O)CCc1ccc2ccccc2c1)COC(=O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C66H67NO12/c68-61(33-25-47-21-29-51-11-1-5-15-55(51)39-47)74-43-59(44-75-62(69)34-26-48-22-30-52-12-2-6-16-56(52)40-48)78-65(72)19-9-37-67-38-10-20-66(73)79-60(45-76-63(70)35-27-49-23-31-53-13-3-7-17-57(53)41-49)46-77-64(71)36-28-50-24-32-54-14-4-8-18-58(54)42-50/h1-8,11-18,21-24,29-32,39-42,59-60,67H,9-10,19-20,25-28,33-38,43-46H2 |
| InChIKey | BAHBLPKZCCDLOP-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.26 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|