C47H63Br2O11P — CID 18607950
[1-[(2R)-3-(10-anthracen-2-yldecanoyloxy)-2-[10-(3,5-dibromo-4-methoxyphenyl)decanoyloxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid (PubChem CID 18607950) has the molecular formula C47H63Br2O11P and a molecular weight of 994.79 g/mol. Its IUPAC name is [1-[(2R)-3-(10-anthracen-2-yldecanoyloxy)-2-[10-(3,5-dibromo-4-methoxyphenyl)decanoyloxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid.
| Compound Name | [1-[(2R)-3-(10-anthracen-2-yldecanoyloxy)-2-[10-(3,5-dibromo-4-methoxyphenyl)decanoyloxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 18607950 |
| Molecular Formula | C47H63Br2O11P |
| Molecular Weight | 994.79 g/mol |
| Exact Mass | 992.25 |
| IUPAC Name | [1-[(2R)-3-(10-anthracen-2-yldecanoyloxy)-2-[10-(3,5-dibromo-4-methoxyphenyl)decanoyloxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
| SMILES | COc1c(Br)cc(CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCc2ccc3cc4ccccc4cc3c2)COC(C(O)CO)P(=O)(O)O)cc1Br |
| InChI | InChI=1S/C47H63Br2O11P/c1-57-46-41(48)27-35(28-42(46)49)19-13-9-5-3-7-11-15-23-45(53)60-40(33-59-47(43(51)31-50)61(54,55)56)32-58-44(52)22-14-10-6-2-4-8-12-18-34-24-25-38-29-36-20-16-17-21-37(36)30-39(38)26-34/h16-17,20-21,24-30,40,43,47,50-51H,2-15,18-19,22-23,31-33H2,1H3,(H2,54,55,56)/t40-,43?,47?/m1/s1 |
| InChIKey | ILPGCEVPZSQDAL-GAQXUWJFSA-N |
| XLogP | 10.88 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.79 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|