C47H85NO2 — CID 130236031
2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-N,N-dimethylcyclopentan-1-amine (PubChem CID 130236031) has the molecular formula C47H85NO2 and a molecular weight of 696.20 g/mol. Its IUPAC name is 2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-N,N-dimethylcyclopentan-1-amine.
| Compound Name | 2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-N,N-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 130236031 |
| Molecular Formula | C47H85NO2 |
| Molecular Weight | 696.20 g/mol |
| Exact Mass | 695.66 |
| IUPAC Name | 2-[[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]methyl]-N,N-dimethylcyclopentan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CC2CCCC2N(C)C)O1 |
| InChI | InChI=1S/C47H85NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-47(49-43-45(50-47)42-44-38-37-39-46(44)48(3)4)41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,44-46H,5-12,17-18,23-43H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | CYIFLURUBJXITO-KWXKLSQISA-N |
| XLogP | 14.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.20 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|