C8H8N2O3 — CID 130238345
2-(aziridine-1-carbonyl)furan-3-carboxamide (PubChem CID 130238345) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(aziridine-1-carbonyl)furan-3-carboxamide.
| Compound Name | 2-(aziridine-1-carbonyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 130238345 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(aziridine-1-carbonyl)furan-3-carboxamide |
| SMILES | NC(=O)c1ccoc1C(=O)N1CC1 |
| InChI | InChI=1S/C8H8N2O3/c9-7(11)5-1-4-13-6(5)8(12)10-2-3-10/h1,4H,2-3H2,(H2,9,11) |
| InChIKey | XLLUJLOZGFYPGI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|