C10H9NO4 — CID 131003233
2-(2,5-dihydropyrrole-1-carbonyl)furan-3-carboxylic acid (PubChem CID 131003233) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-(2,5-dihydropyrrole-1-carbonyl)furan-3-carboxylic acid.
| Compound Name | 2-(2,5-dihydropyrrole-1-carbonyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 131003233 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-(2,5-dihydropyrrole-1-carbonyl)furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1C(=O)N1CC=CC1 |
| InChI | InChI=1S/C10H9NO4/c12-9(11-4-1-2-5-11)8-7(10(13)14)3-6-15-8/h1-3,6H,4-5H2,(H,13,14) |
| InChIKey | HFFGGJBZFDLPQT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|