C11H11NO7 — CID 175955760
furan-2,3-dicarboxylic acid;piperidine-2,6-dione (PubChem CID 175955760) has the molecular formula C11H11NO7 and a molecular weight of 269.21 g/mol. Its IUPAC name is furan-2,3-dicarboxylic acid;piperidine-2,6-dione.
| Compound Name | furan-2,3-dicarboxylic acid;piperidine-2,6-dione |
|---|---|
| PubChem CID | 175955760 |
| Molecular Formula | C11H11NO7 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | furan-2,3-dicarboxylic acid;piperidine-2,6-dione |
| SMILES | O=C(O)c1ccoc1C(=O)O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C6H4O5.C5H7NO2/c7-5(8)3-1-2-11-4(3)6(9)10;7-4-2-1-3-5(8)6-4/h1-2H,(H,7,8)(H,9,10);1-3H2,(H,6,7,8) |
| InChIKey | LKKIISVLBNABBQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|