C12H22N2O5 — CID 130238694
ethyl (2R)-2-methyl-2-(methylamino)-3-(oxan-2-yloxyamino)-3-oxopropanoate (PubChem CID 130238694) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl (2R)-2-methyl-2-(methylamino)-3-(oxan-2-yloxyamino)-3-oxopropanoate.
| Compound Name | ethyl (2R)-2-methyl-2-(methylamino)-3-(oxan-2-yloxyamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 130238694 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | ethyl (2R)-2-methyl-2-(methylamino)-3-(oxan-2-yloxyamino)-3-oxopropanoate |
| SMILES | CCOC(=O)[C@](C)(NC)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C12H22N2O5/c1-4-17-11(16)12(2,13-3)10(15)14-19-9-7-5-6-8-18-9/h9,13H,4-8H2,1-3H3,(H,14,15)/t9?,12-/m1/s1 |
| InChIKey | XQWNVHABNWJRFQ-FFFFSGIJSA-N |
| XLogP | 0.10 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|