C16H16F3N3O — CID 130239056
2-[5-[2-methanimidoyl-4-(trifluoromethyl)anilino]-3-pyridinyl]propan-2-ol (PubChem CID 130239056) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-[5-[2-methanimidoyl-4-(trifluoromethyl)anilino]-3-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[2-methanimidoyl-4-(trifluoromethyl)anilino]-3-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 130239056 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[5-[2-methanimidoyl-4-(trifluoromethyl)anilino]-3-pyridinyl]propan-2-ol |
| SMILES | [H]/N=C/c1cc(C(F)(F)F)ccc1Nc1cncc(C(C)(C)O)c1 |
| InChI | InChI=1S/C16H16F3N3O/c1-15(2,23)12-6-13(9-21-8-12)22-14-4-3-11(16(17,18)19)5-10(14)7-20/h3-9,20,22-23H,1-2H3/b20-7+ |
| InChIKey | FUVJKEGLGPNBHH-IFRROFPPSA-N |
| XLogP | 4.07 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|