C12H16OS — CID 130239610
1-(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenol (PubChem CID 130239610) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenol.
| Compound Name | 1-(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenol |
|---|---|
| PubChem CID | 130239610 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1-(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl)ethenol |
| SMILES | C=C(O)c1csc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C12H16OS/c1-8(13)10-7-14-11-4-5-12(2,3)6-9(10)11/h7,13H,1,4-6H2,2-3H3 |
| InChIKey | HGSFBQXFCXODGW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|