C15H27N — CID 130242925
N,4,5,7-tetramethyl-6-prop-1-en-2-ylocta-5,7-dien-1-amine (PubChem CID 130242925) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N,4,5,7-tetramethyl-6-prop-1-en-2-ylocta-5,7-dien-1-amine.
| Compound Name | N,4,5,7-tetramethyl-6-prop-1-en-2-ylocta-5,7-dien-1-amine |
|---|---|
| PubChem CID | 130242925 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N,4,5,7-tetramethyl-6-prop-1-en-2-ylocta-5,7-dien-1-amine |
| SMILES | C=C(C)C(C(=C)C)=C(C)C(C)CCCNC |
| InChI | InChI=1S/C15H27N/c1-11(2)15(12(3)4)14(6)13(5)9-8-10-16-7/h13,16H,1,3,8-10H2,2,4-7H3 |
| InChIKey | GJGSTOXGYOHNSA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|