C25H40N4O3S — CID 130244110
butyl N-[(2R)-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-4-oxo-1-phenylsulfanylbutan-2-yl]carbamate (PubChem CID 130244110) has the molecular formula C25H40N4O3S and a molecular weight of 476.69 g/mol. Its IUPAC name is butyl N-[(2R)-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-4-oxo-1-phenylsulfanylbutan-2-yl]carbamate.
| Compound Name | butyl N-[(2R)-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-4-oxo-1-phenylsulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 130244110 |
| Molecular Formula | C25H40N4O3S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | butyl N-[(2R)-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-4-oxo-1-phenylsulfanylbutan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](CSc1ccccc1)CC(=O)N1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C25H40N4O3S/c1-3-4-18-32-25(31)26-21(20-33-23-8-6-5-7-9-23)19-24(30)29-16-14-28(15-17-29)22-10-12-27(2)13-11-22/h5-9,21-22H,3-4,10-20H2,1-2H3,(H,26,31)/t21-/m1/s1 |
| InChIKey | KOWKWHJELBDWEU-OAQYLSRUSA-N |
| XLogP | 3.30 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|