C14H39N2PSi3 — CID 13025016
2-[[bis(trimethylsilyl)amino]-methyl-trimethylsilylimino-λ5-phosphanyl]-2-methylpropane (PubChem CID 13025016) has the molecular formula C14H39N2PSi3 and a molecular weight of 350.71 g/mol. Its IUPAC name is 2-[[bis(trimethylsilyl)amino]-methyl-trimethylsilylimino-λ5-phosphanyl]-2-methylpropane.
| Compound Name | 2-[[bis(trimethylsilyl)amino]-methyl-trimethylsilylimino-λ5-phosphanyl]-2-methylpropane |
|---|---|
| PubChem CID | 13025016 |
| Molecular Formula | C14H39N2PSi3 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-[[bis(trimethylsilyl)amino]-methyl-trimethylsilylimino-λ5-phosphanyl]-2-methylpropane |
| SMILES | CC(C)(C)P(C)(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H39N2PSi3/c1-14(2,3)17(4,15-18(5,6)7)16(19(8,9)10)20(11,12)13/h1-13H3 |
| InChIKey | VXZMTDNGBMCVBR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|