C8H21N2OPSi — CID 10536921
1-[dimethyl(trimethylsilylimino)-lambda5-phosphanyl]-N,N-dimethylformamide (PubChem CID 10536921) has the molecular formula C8H21N2OPSi and a molecular weight of 220.33 g/mol. Its IUPAC name is 1-[dimethyl(trimethylsilylimino)-lambda5-phosphanyl]-N,N-dimethylformamide.
| Compound Name | 1-[dimethyl(trimethylsilylimino)-lambda5-phosphanyl]-N,N-dimethylformamide |
|---|---|
| PubChem CID | 10536921 |
| Molecular Formula | C8H21N2OPSi |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-[dimethyl(trimethylsilylimino)-lambda5-phosphanyl]-N,N-dimethylformamide |
| SMILES | CN(C)C(=O)P(C)(C)=N[Si](C)(C)C |
| InChI | InChI=1S/C8H21N2OPSi/c1-10(2)8(11)12(3,4)9-13(5,6)7/h1-7H3 |
| InChIKey | QYWVLGUOSAIJKH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|