About 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide
7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide (PubChem CID 130251228) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide.
Analyze 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide?
The IUPAC name of 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide (CID 130251228) is 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide.
What is the SMILES notation for 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide?
The canonical SMILES for 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide is Cc1cc2c(cn1)CCS(=O)(=O)C2.
What is the InChIKey of 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide?
The InChIKey is KJIQSTIQCMUHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-7-4-9-6-13(11,12)3-2-8(9)5-10-7/h4-5H,2-3,6H2,1H3.
What are the key properties of 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide?
7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide has a molecular weight of 197.26 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine 2,2-dioxide is sourced from PubChem (CID 130251228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).