About 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide
5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide (PubChem CID 176947713) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide.
Analyze 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide?
The IUPAC name of 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide (CID 176947713) is 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide.
What is the SMILES notation for 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide?
The canonical SMILES for 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide is Cc1cc2c(cn1)S(=O)(=O)CC2.
What is the InChIKey of 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide?
The InChIKey is VYTMLZIBPMWMTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c1-6-4-7-2-3-12(10,11)8(7)5-9-6/h4-5H,2-3H2,1H3.
What are the key properties of 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide?
5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide has a molecular weight of 183.23 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydrothieno[2,3-c]pyridine 1,1-dioxide is sourced from PubChem (CID 176947713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).